3H-L365,260
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 120 |
|---|---|
| Ligand Name | 3H-L365,260 |
| PubMed Compound ID | 104929 |
| Structure | |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.5 |
| SMILES | CC1=CC(=CC=C1)NC(=O)NC2C(=O)N(C3=CC=CC=C3C(=N2)C4=CC=CC=C4)C |
| Synonyms | CHEMBL289498 (R)-L 365260 L365260 [3H]L365260 [3H]L-365,260 GTPL879 GTPL3477 SCHEMBL1650330 SCHEMBL29694194 DTXSID30922600 KDFQABSFVYLGPM-UHFFFAOYSA-N BDBM50452555 L000333 N-(1-Methyl-2-oxo-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-3-yl)-N'-(3-methylphenyl)carbamimidic acid N-(2,3-Dihydro-1-methyl-2-oxo-5-phenyl-1H-1,4-benzodiazepin-3-yl)-N'-(3-methylphenyl)-urea |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |