125I-[MePhe7]-NKB
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 148 |
|---|---|
| Ligand Name | 125I-[MePhe7]-NKB |
| PubMed Compound ID | 155817453 |
| Structure | |
| Molecular Formula | C60H81N13O14S2 |
| Molecular Weight | 1272.5 |
| SMILES | CC1=CC=C(C=C1)C[C@@H](C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N)NC(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@H](CC3=CC=CC=C3)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC4=CN=CN4)NC(=O)[C@H](CCSC)NC(=O)[C@H](CC(=O)O)N |
| Synonyms | [125I][MePhe7]NKB [125I]-[MePhe7]NKB GTPL3763 [125I]-[MePhe7]neurokinin A |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |