3H-Norepinephrine
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 198 |
|---|---|
| Ligand Name | 3H-Norepinephrine |
| PubMed Compound ID | 71717902 |
| Structure | |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 171.19 |
| SMILES | [3H][C@](CN)(C1=CC(=C(C=C1)O)O)O |
| Synonyms | [3H]norepinephrine (3H)Norepinephrine RefChem:1050231 [3H]-Norepinephrine CHEMBL2311152 SCHEMBL29690840 SFLSHLFXELFNJZ-CMIMLBRMSA-N |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |