125I-BOP
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
 - Ligand Name - Unique name of the hot ligand
 - PubMed Compound ID - Unique Compound ID in PubMed datbase
 
| Hot Ligand | 209 | 
|---|---|
| Ligand Name | 125I-BOP | 
| PubMed Compound ID | 23986047 | 
| Structure | |
| Molecular Formula | C23H29IO5 | 
| Molecular Weight | 510.4 | 
| SMILES | C1C[C@@H]2[C@@H]([C@H]([C@H]1O2)C/C=C/CCCC(=O)O)/C=C/[C@H](COC3=CC=C(C=C3)[125I])O | 
| Synonyms | [125I]BOP [125I]-I-BOP (125I)BOP (125I)-I-BOP (5E)-7-[(1S,2R,3R,4R)-3-[(1E,3R)-3-hydroxy-4-[4-(125I)iodophenoxy]but-1-en-1-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (5E)-7-((1S,2R,3R,4R)-3-((1E,3R)-3-hydroxy-4-(4-(125I)iodophenoxy)but-1-en-1-yl)-7-oxabicyclo(2.2.1)heptan-2-yl)hept-5-enoic acid RefChem:68204 GTPL1973 PDSP2_001672  | 
| Created At | Jan 14, 2025 10:59 am | 
| Updated At | Jan 14, 2025 10:59 am |