3H-Strychnine
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 228 |
|---|---|
| Ligand Name | 3H-Strychnine |
| PubMed Compound ID | 5979 |
| Structure | |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.4 |
| SMILES | C1CN2CC3=CCOC4CC(=O)N5C6[C@H]4[C@H]3C[C@H]2[C@@]61C7=CC=CC=C75 |
| Synonyms | RefChem:1050458 (4Ar,5As,8Ar,15Br)-4A,5,5A,7,8,13A,15,15A,15B,16-Decahydro-2H-4,6-Methanoindolo(3,2,1-Ij)Oxepino(2,3,4-De)Pyrrolo(2,3-H)Quinoline-14-One 3h-strychnine Prestwick_34 CHEMBL33495 SCHEMBL29352583 |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |