3H-Lysergic
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 255 |
|---|---|
| Ligand Name | 3H-Lysergic |
| PubMed Compound ID | 44559100 |
| Structure | |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 329.5 |
| SMILES | [3H]C([3H])([3H])N1C[C@@H](C=C2[C@H]1CC3=CNC4=CC=CC2=C34)C(=O)N(CC)CC |
| Synonyms | [3H]LSD [3H]lysergide [3H]N,N-Diethyllysergamide [3H]lysergic acid diethylamide (3H)lysergide (3H)Lsd (3H)N,N-diethyllysergamide (3H)lysergic acid diethylamide (6aR,9R)-N,N-diethyl-7-(tritritiomethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (6aR,9R)-N,N-diethyl-7-(tritritiomethyl)-6,6a,8,9-tetrahydro-4H-indolo(4,3-fg)quinoline-9-carboxamide RefChem:69217 CHEMBL463207 GTPL219 SCHEMBL29431887 SCHEMBL29508685 VAYOSLLFUXYJDT-QZGBZKRISA-N |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |