125I-Iodoproxyfan
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 295 |
|---|---|
| Ligand Name | 125I-Iodoproxyfan |
| PubMed Compound ID | 449663 |
| Structure | |
| Molecular Formula | C13H15IN2O |
| Molecular Weight | 338.18 |
| SMILES | C1=CC(=CC=C1COCCCC2=CN=CN2)[123I] |
| Synonyms | [123I]iodoproxyfan [125I]-iodoproxyfan GTPL1264 MOLI000033 |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |