125I-Iodoproxyfan
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
 - Ligand Name - Unique name of the hot ligand
 - PubMed Compound ID - Unique Compound ID in PubMed datbase
 
| Hot Ligand | 295 | 
|---|---|
| Ligand Name | 125I-Iodoproxyfan | 
| PubMed Compound ID | 449663 | 
| Structure | |
| Molecular Formula | C13H15IN2O | 
| Molecular Weight | 338.18 | 
| SMILES | C1=CC(=CC=C1COCCCC2=CN=CN2)[123I] | 
| Synonyms | [123I]iodoproxyfan [125I]-iodoproxyfan GTPL1264 MOLI000033  | 
| Created At | Jan 14, 2025 10:59 am | 
| Updated At | Jan 14, 2025 10:59 am |