3H-cyclohexyladenosine
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 314 |
|---|---|
| Ligand Name | 3H-cyclohexyladenosine |
| PubMed Compound ID | 66601354 |
| Structure | |
| Molecular Formula | C16H23N5O4 |
| Molecular Weight | 349.38 |
| SMILES | C1CCC(CC1)[C@@]2([C@@H]([C@@H]([C@H](O2)CO)O)O)N3C=NC4=C(N=CN=C43)N |
| Synonyms | cyclohexyladenosine cyclohexyl-adenosine cyclohexyl-(3h)adenosine SCHEMBL120561 CHEBI:232101 CHMUHOFITZIING-XNIJJKJLSA-N |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |