3H-CGP39653
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 391 |
|---|---|
| Ligand Name | 3H-CGP39653 |
| PubMed Compound ID | 114756 |
| Structure | |
| Molecular Formula | C8H16NO5P |
| Molecular Weight | 237.19 |
| SMILES | CCCC(=CC(C(=O)O)N)CP(=O)(O)O |
| Synonyms | RefChem:909558 2-Amino-4-propyl-5-phosphono-3-pentenoic acid [3H]CGP39653 2-amino-4-(phosphonomethyl)hept-3-enoic acid SCHEMBL499893 GTPL4078 |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |