125I-SB-207710
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 40 |
|---|---|
| Ligand Name | 125I-SB-207710 |
| PubMed Compound ID | 15406414 |
| Structure | |
| Molecular Formula | C19H27IN2O4 |
| Molecular Weight | 472.3 |
| SMILES | CCCCN1CCC(CC1)COC(=O)C2=CC(=C(C3=C2OCCO3)N)[125I] |
| Synonyms | Y22GRV2JAZ (125I)Sb 207710 620165-50-6 SB-207710 I-125 1,4-Benzodioxin-5-carboxylic acid, 8-amino-2,3-dihydro-7-(iodo-125I)-, (1-butyl-4-piperidinyl)methyl ester |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |