FNZ
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 49 |
|---|---|
| Ligand Name | FNZ |
| PubMed Compound ID | 5494421 |
| Structure | |
| Molecular Formula | C18H15FN4O |
| Molecular Weight | 322.3 |
| SMILES | C1=CC(=CC=C1C[C@H]([C@H](C2=CC=C(C=C2)C#N)N3C=NC=N3)O)F |
| Synonyms | 4-[(1S,2R)-3-(4-fluorophenyl)-2-hydroxy-1-(1H-1,2,4-triazol-1-yl)propyl]benzonitrile CHEBI:42665 4-[(1S,2R)-3-(4-fluorophenyl)-2-hydroxy-1-(1,2,4-triazol-1-yl)propyl]benzonitrile 2c1p Epitope ID:164029 FNZ Q27120479 |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |