125I-ABOPX
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 496 |
|---|---|
| Ligand Name | 125I-ABOPX |
| PubMed Compound ID | 14016348 |
| Structure | |
| Molecular Formula | C23H22IN5O5 |
| Molecular Weight | 573.4 |
| SMILES | CCCN1C(=O)C2=C(N=C(N2)C3=CC=C(C=C3)OCC(=O)O)N(C1=O)CC4=CC(=C(C=C4)N)[125I] |
| Synonyms | [125I]ABOPX GTPL452 [125I]3-(3,4-aminobenzyl)-8-(4-oxyacetate)phenyl-1-propyl-xanthine |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |