3H-M-MPEP
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 572 |
|---|---|
| Ligand Name | 3H-M-MPEP |
| PubMed Compound ID | 5311462 |
| Structure | |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.27 |
| SMILES | CC1=NC(=CC=C1)C#CC2=CC(=CC=C2)OC |
| Synonyms | M-MPEP methoxy-MPEP 2-[2-(3-methoxyphenyl)ethynyl]-6-methylpyridine CHEMBL332397 2-methyl-6-((3-methoxyphenyl)ethynyl)-pyridine 219914-59-7 2-((3-Methoxyphenyl)ethynyl)-6-methylpyridine 2-[2-(3-methoxyphenyl)ethynyl]-6-methyl-pyridine [3H]M-MPEP [3H]-M-MPEP 2-(3-methoxyphenylethynyl)-6-methylpyridine GTPL1425 GTPL3344 SCHEMBL1020513 SCHEMBL29393403 BDBM50123005 PDSP1_000362 PDSP2_000360 DB-329259 2-(3-Methoxy-phenylethynyl)-6-methyl-pyridine Q27085274 D8B |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |