3H-CGP-62349
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 590 |
|---|---|
| Ligand Name | 3H-CGP-62349 |
| PubMed Compound ID | 5310936 |
| Structure | |
| Molecular Formula | C21H28NO6P |
| Molecular Weight | 421.4 |
| SMILES | C[C@H](C1=CC(=CC=C1)C(=O)O)N(C)C[C@@H](CP(=O)(CC2=CC=C(C=C2)OC)O)O |
| Synonyms | CGP 62349 3-[(1R)-1-[[(2S)-2-hydroxy-3-[hydroxy-[(4-methoxyphenyl)methyl]phosphoryl]propyl]-methylamino]ethyl]benzoic acid CGP-62349 10-31-1 DTXSID80415496 3-((1R)-1-(((2S)-2-hydroxy-3-(hydroxy-((4-methoxyphenyl)methyl)phosphoryl)propyl)-methylamino)ethyl)benzoic acid RefChem:918311 DTXCID10366346 187608-26-0 CGP62349 [3H]CGP62349 [3H]-CGP 62349 GTPL1072 GTPL3429 SCHEMBL12477448 CID 5310936 Q27075923 ((3-1-(R)-((4-methoxyphenyl-methyl)hydroxyphosphinyl)-2-(S)-hydroxypropyl)aminoethyl)benzoic acid |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |