3H-PSB-298
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 629 |
|---|---|
| Ligand Name | 3H-PSB-298 |
| PubMed Compound ID | 146160171 |
| Structure | |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 393.4 |
| SMILES | [3H]C([3H])C([3H])([3H])CN1C(=O)C2=NC(=NC2=NC1=O)C3=CC=C(C=C3)OCC(=O)NCCO |
| Synonyms | [3H]PSB-298 917987-68-9 2-[4-[2,6-dioxo-1-(2,2,3,3-tetratritiopropyl)purin-8-yl]phenoxy]-N-(2-hydroxyethyl)acetamide |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |