125I-IMPY
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 661 |
|---|---|
| Ligand Name | 125I-IMPY |
| PubMed Compound ID | 6518166 |
| Structure | |
| Molecular Formula | C15H14IN3 |
| Molecular Weight | 361.20 |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CN3C=C(C=CC3=N2)[125I] |
| Synonyms | [125I]IMPY CHEMBL71696 SCHEMBL11994267 [125I]6-Iodo-2-(4 -dimethylamino)-phenyl-imidazo(1,2-a)pyridine |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |