14C-Glutamic acid
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 693 |
|---|---|
| Ligand Name | 14C-Glutamic acid |
| PubMed Compound ID | 168158 |
| Structure | |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 149.12 |
| SMILES | C(C[14C](=O)O)[C@@H](C(=O)O)N |
| Synonyms | L-Glutamic-5-14C acid 24016-48-6 (2S)-2-amino(514C)pentanedioic acid (1-14C)Glutamic acid starbld0003602 (5-~14~C)Glutamic acid Glutamic acid,l-,[5-14c] DTXSID60946854 AKOS040752558 |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |