3H-NBTI
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
 - Ligand Name - Unique name of the hot ligand
 - PubMed Compound ID - Unique Compound ID in PubMed datbase
 
| Hot Ligand | 695 | 
|---|---|
| Ligand Name | 3H-NBTI | 
| PubMed Compound ID | 135796589 | 
| Structure | |
| Molecular Formula | C17H17N5O7S | 
| Molecular Weight | 435.4 | 
| SMILES | C1=CC=C(C(=C1)CS[C@@]2([C@@H]([C@@H]([C@H](O2)CO)O)O)N3C=NC4=C3N=CNC4=O)[N+](=O)[O-] | 
| Synonyms | Nitrobenzylmercaptopurine Ribonucleoside [3H]NBTI [3H]-NBTI (2S,3R,4S,5R)-2-(6-hydroxy-9H-purin-9-yl)-5-(hydroxymethyl)-2-{[(2-nitrophenyl)methyl]sulfanyl}oxolane-3,4-diol [3H]nitrobenzylmercaptopurine ribonucleoside [3H]NBMPR SCHEMBL290700 GTPL4511 GTPL4512 Q27087938  | 
| Created At | Jan 14, 2025 10:59 am | 
| Updated At | Jan 14, 2025 10:59 am |