3H-Dofetilide
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 715 |
|---|---|
| Ligand Name | 3H-Dofetilide |
| PubMed Compound ID | 169490876 |
| Structure | |
| Molecular Formula | C19H27N3O5S2 |
| Molecular Weight | 447.6 |
| SMILES | [3H]C([3H])([3H])N(CCC1=CC=C(C=C1)NS(=O)(=O)C)CCOC2=CC=C(C=C2)NS(=O)(=O)C |
| Synonyms | [3H]Dofetilide Dofetilide H-3 K46LKD24P7 2086336-96-9 Methanesulfonamide, N-[4-[2-[methyl-t3-[2-[4-[(methylsulfonyl)amino]phenoxy]ethyl]amino]ethyl]phenyl]- N-[4-[2-[Methyl-t3-[2-[4-[(methylsulfonyl)amino]phenoxy]ethyl]amino]ethyl]phenyl]methanesulfonamide |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |