35S-TBPS
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 76 |
|---|---|
| Ligand Name | 35S-TBPS |
| PubMed Compound ID | 59896759 |
| Structure | |
| Molecular Formula | C8H15O3PS |
| Molecular Weight | 225.15 |
| SMILES | CC(C)(C)C12COP(=[35S])(OC1)OC2 |
| Synonyms | [35S]TBPS GTPL4369 SCHEMBL29393334 4-tert-butyl-1-sulfanylidene-2,6,7-trioxa-1$l^{5}-phosphabicyclo[2.2.2]octane |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |