3H-N6 -phenylisopropyladenosine
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 799 |
|---|---|
| Ligand Name | 3H-N6 -phenylisopropyladenosine |
| PubMed Compound ID | 67918947 |
| Structure | |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.4 |
| SMILES | CC(C)[C@@]1([C@@H]([C@@H]([C@H](O1)CO)O)O)N2C=NC3=C(N=CN=C32)NC4=CC=CCC4 |
| Synonyms | SCHEMBL9744728 SCHEMBL30047757 (-)[3h]n6-phenylisopropyladenosine |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |