[3H]AP4
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 812 |
|---|---|
| Ligand Name | [3H]AP4 |
| PubMed Compound ID | 179394 |
| Structure | |
| Molecular Formula | C4H10NO5P |
| Molecular Weight | 183.10 |
| SMILES | C(CP(=O)(O)O)[C@@H](C(=O)O)N |
| Synonyms | (2S)-2-amino-4-phosphonobutanoic acid L-AP-4 (s)-2-amino-4-phosphonobutyric acid (2S)-2-amino-4-phosphonobutyric acid CHEBI:143992 DTXSID30945733 L-(+)-2-amino-4-phosphonobutanoic acid RefChem:398336 DTXCID901374043 L-AP4 23052-81-5 L-(+)-2-Amino-4-phosphonobutyric acid (S)-2-amino-4-phosphonobutanoic acid L-APB Butanoic acid, 2-amino-4-phosphono-, (2S)- CHEMBL33567 C8M58SS68H L(+)-2-Amino-4-phosphonobutanoic acid (L-AP4) 2-Amino-4-phosphonobutyric acid, (S)- C4H10NO5P L-AP 4 2-Amino-4-phosphono-butyric acid S-2-amino-4-phosphonobutyrate [3H]AP4 L-2-amino-4-phosphonobutiric acid E7P L-1-amino-4-phosphonobutanoic acid l(+)-2-amino-4-phosphonobutanoic acid Tocris-0103 145236-29-9 NCIStruc1_000162 NCIStruc2_000128 UNII-C8M58SS68H GTPL1410 GTPL1412 orb1707109 SCHEMBL1969235 L-2-amino-4-phosphonobutanoic acid NCI30079 BDBM50007548 CCG-37553 HB0370 MFCD00083244 NCGC00013365 STL564864 AKOS006239562 (S)-2-Amino-4-phosphono-butyric acid FA01291 HY-100781A NCGC00013365-02 NCGC00013365-03 NCGC00024468-01 NCGC00024468-02 (2S)-2-amino-4-phosphono-butanoic acid DA-64860 2-Amino-4-phosphono-butyric acid(S-AP4) Butanoic acid,2-amino-4-phosphono-,(2S)- CS-0020419 M01257 BUTYRIC ACID, 2-AMINO-4-PHOSPHONO-, L- S-(+)-2-AMINO-4-PHOSPHONOBUTANOIC ACID SR-01000597692 BUTANOIC ACID, 2-AMINO-4-PHOSPHONO-, (S)- Q6456089 SR-01000597692-1 L-(+)-2-Amino-4-phosphonobutyric Acid - CAS 23052-81-5 2-Amino-3-(3,5-dioxo-[1,2,4]oxadiazolidin-2-yl)-propionic acid (S)?-?(+)?-?2-?Amino-?4-?phosphonobutyric acid;L-(+)-2-Amino-4-phosphonobutyric acid L-(+)-2-Amino-4-phosphonobutyric acid, optical purity optical purity: >=95% (HPLC, Marfey's reagent) |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |