125I-iodophenpropit
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 825 |
|---|---|
| Ligand Name | 125I-iodophenpropit |
| PubMed Compound ID | 5311186 |
| Structure | |
| Molecular Formula | C15H21IN4S |
| Molecular Weight | 416.3 |
| SMILES | C1=CC(=CC=C1CCN[C@H](N)SCCCC2=CN=CN2)I |
| Synonyms | [125I]IODOPHENPROPIT (1S)-1-[3-(3H-imidazol-4-yl)propylsulfanyl]-N-[2-(4-iodophenyl)ethyl]methanediamine GTPL1266 GTPL3960 |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |