3H-Melatonin
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 835 |
|---|---|
| Ligand Name | 3H-Melatonin |
| PubMed Compound ID | 71358229 |
| Structure | |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 |
| SMILES | CC(=O)NCCC1C=NC2=C1C=C(C=C2)OC |
| Synonyms | N-[2-(5-Methoxy-3H-indol-3-yl)ethyl]acetamide 216499-78-4 3h-melatonin DTXSID50782248 |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |