3H-Losartan
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 846 |
|---|---|
| Ligand Name | 3H-Losartan |
| PubMed Compound ID | 129716889 |
| Structure | |
| Molecular Formula | C22H22ClKN6O |
| Molecular Weight | 461.0 |
| SMILES | CCC/C=C/1\NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C4=NN=N[N-]4)CO)Cl.[K+] |
| Synonyms | 3h-losartan |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |