125I-Insulin
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 865 |
|---|---|
| Ligand Name | 125I-Insulin |
| PubMed Compound ID | 135652523 |
| Structure | |
| Molecular Formula | C17H18N4O6 |
| Molecular Weight | 374.3 |
| SMILES | CC(=O)N1C(CC(=N1)C2=C(N(C(=O)NC2=O)C)O)C3=CC(=C(C=C3)O)OC |
| Synonyms | (Z)-5-(1-acetyl-5-(4-hydroxy-3-methoxyphenyl)pyrazolidin-3-ylidene)-1-methylpyrimidine-2,4,6(1H,3H,5H)-trione STK614226 AKOS005548689 AKOS032399611 (5Z)-5-[1-acetyl-5-(4-hydroxy-3-methoxyphenyl)pyrazolidin-3-ylidene]-6-hydroxy-3-methylpyrimidine-2,4(3H,5H)-dione |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |