[3H]5-CT
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 931 |
|---|---|
| Ligand Name | [3H]5-CT |
| PubMed Compound ID | 53324620 |
| Structure | |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 211.27 |
| SMILES | [3H]C([3H])(C1=CNC2=C1C=C(C=C2)C(=O)N)C([3H])([3H])N |
| Synonyms | [3H]5-CT [3H]5-carboxamidotryptamine tritiated 5-carbamidotryptamine (3H)5-carboxamidotryptamine (3H)5-CT 3-(2-amino-1,1,2,2-tetratritioethyl)-1H-indole-5-carboxamide RefChem:69203 GTPL262 SCHEMBL30228679 |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |