[125I]-Iodoaminopotentidine
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 942 |
|---|---|
| Ligand Name | [125I]-Iodoaminopotentidine |
| PubMed Compound ID | 73755000 |
| Structure | |
| Molecular Formula | C26H34IN7O2 |
| Molecular Weight | 601.5 |
| SMILES | C1CCN(CC1)CC2=CC(=CC=C2)OCCCN=C(NCCNC(=O)C3=CC(=C(C=C3)N)[125I])NC#N |
| Synonyms | [125I]APT [125I]IODOAMINOPOTENTIDINE [125I]-iodoaminopotentidine 125I-Aminopotentidine 125I-APT 7V2P9T4UB4 GTPL1230 SCHEMBL29565308 APT I-125 142828-09-9 Benzamide, 4-amino-N-[2-[[(cyanoamino)[[3-[3-(1-piperidinylmethyl)phenoxy]propyl]amino]methylene]amino]ethyl]-3-(iodo-125I)- |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |