[3H]Pentazocine
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 959 |
|---|---|
| Ligand Name | [3H]Pentazocine |
| PubMed Compound ID | 71717297 |
| Structure | |
| Molecular Formula | C19H27NO |
| Molecular Weight | 289.4 |
| SMILES | [3H]C1=CC2=C(C(=C1O)[3H])[C@]3(CCN([C@@H](C2)[C@H]3C)CC=C(C)C)C |
| Synonyms | [3H]pentazocine (3H)PENTAZOCINE RefChem:69225 CHEMBL2311194 GTPL6683 SCHEMBL29622629 |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |