3H-ILOPROST
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 97 |
|---|---|
| Ligand Name | 3H-ILOPROST |
| PubMed Compound ID | 53320668 |
| Structure | |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 362.5 |
| SMILES | [3H]C\1[C@H]2C[C@H]([C@@H]([C@H]2C/C1=C/CCCC(=O)O)/C=C/[C@H](C(C)CC#CC)O)O |
| Synonyms | [3H]iloprost [3H]-Iloprost [3H]ciloprost [3H]ventavis GTPL1966 SCHEMBL29565277 (5Z)-5-[(3aS,4R,5R,6aR)-5-hydroxy-4-[(E,3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-1-tritio-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |