[3H]ZM-241385
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 978 |
|---|---|
| Ligand Name | [3H]ZM-241385 |
| PubMed Compound ID | 53316647 |
| Structure | |
| Molecular Formula | C16H15N7O2 |
| Molecular Weight | 339.34 |
| SMILES | [3H]C1=CC(=CC=C1O)CCNC2=NC3=NC(=NN3C(=N2)N)C4=CC=CO4 |
| Synonyms | [3H]ZM 241385 [3H]-ZM241385 GTPL455 CHEMBL1628684 SCHEMBL29443965 [3H]-ZM-241385 4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]-2-tritiophenol |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |