LSD
Test Ligands Values Explained
- Test Ligand ID - A unique identifier for the test ligand
- Ligand Name - Name of the test ligand
| Test Ligand ID | 1091 |
|---|---|
| Ligand Name | LSD |
| PubMed Compound Id | 3981 |
| Structure | |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.4 |
| SMILES | CCN(CC)C(=O)C1CN(C2CC3=CNC4=CC=CC(=C34)C2=C1)C |
| Synonyms | D-Lysergic acid N,N-diethylamide (+)-Lysergide-d3 Acid [Street Name] Cubes [Street Name] Royal Blue [Street Name] Pearly gates [Street Name] Heavenly Blue [Street Name] Wedding bells [Street Name] (+)-LSD Lysergsaure diethylamid d-Lysergic acid dethylamide Indolo[4,3-fg]quinoline, ergoline-8-carboxamide deriv. Lysergsaure-N,N-diethylamid D-LSD-25 CHEMBL4764888 SCHEMBL12401704 BDBM86427 CHEBI:182684 VAYOSLLFUXYJDT-UHFFFAOYSA-N CAA12678 LFA76538 NSC_3981 CAS_50-37-3 L000352 9,10-Didehydro-N,N-diethyl-6-methyl-ergoline-8-.beta.-carboxamide Ergoline-8.beta.-carboxamide, 9,10-didehydro-N,N-diethyl-6-methyl- Ergoline-8-carboxamide, 9,10-didehydro-N,N-diethyl-6-methyl-, (8.beta.)- N,N-Diethyl-6-methyl-9,10-didehydroergoline-8-carboxamide, (8.beta.)- # N,N-diethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-g]quinoline-9-carboxamide |
| Created At | Jan 13, 2025 2:47 pm |
| Updated At | Jan 13, 2025 2:47 pm |