L-cysteic acid
Test Ligands Values Explained
- Test Ligand ID - A unique identifier for the test ligand
- Ligand Name - Name of the test ligand
| Test Ligand ID | 2979 |
|---|---|
| Ligand Name | L-cysteic acid |
| PubMed Compound Id | 72886 |
| Structure | |
| Molecular Formula | C3H7NO5S |
| Molecular Weight | 169.16 |
| SMILES | C([C@@H](C(=O)O)N)S(=O)(=O)O |
| Synonyms | L-Cysteic acid 498-40-8 Cysteinesulfonic acid (R)-2-Amino-3-sulfopropanoic acid Cysteic acid, L- L-Alanine, 3-sulfo- (2R)-2-amino-3-sulfopropanoic acid 3-sulfo-L-alanine Cysteric acid MFCD00007524 Alanine, 3-sulfo-, L- C3H7NO5S Cysteic acid (VAN) Cysteinic acid Cepteic acid Cipteic acid sulfo-D-alanine 2-Amino-3-sulfopropionic acid (2R)-2-amino-3-sulfo-propanoic acid M6W2DJ6N5K L-Cysteate alpha-amino-beta-sulfopropionic acid (R)-cysteate Cysteinesulfonate Cysteic acid; L-3-sulfo-alanine H-Cys(O)2-OH.H2O NSC 254030 OCS UNII-M6W2DJ6N5K NSC-254030 EINECS 207-861-3 bmse000380 L-Cysteic acid (Standard) SCHEMBL44031 L-CYSTEIC ACID [MI] CYSTEIC ACID, (+)- orb1703564 DTXSID7075424 L-Alanine, 3-sulfo- (9CI) CHEBI:17285 MSK1478 Alanine, 3-sulfo-, L- (8CI) AKOS006281833 AKOS015854116 (2R)-2-amino-3-sulfo-propionic acid DB03661 HY-124009R (2R)-2-azanyl-3-sulfo-propanoic acid DS-12037 FC167998 ST079666 SY113770 DB-294486 CS-0083859 NS00014864 C00506 D81957 EN300-302681 F517654 Q29743881 |
| Created At | Jan 13, 2025 2:47 pm |
| Updated At | Jan 13, 2025 2:47 pm |