4-fluoro-N-{3-[1-({3-[(4-{5-[(4-fluorobenzene)amido]-1H-indol-3-yl}piperidin-1-yl)methyl]phenyl}methyl)piperidin-4-yl]-1H-indol-5-yl}benzamide
Test Ligands Values Explained
- Test Ligand ID - A unique identifier for the test ligand
- Ligand Name - Name of the test ligand
| Test Ligand ID | 9504 |
|---|---|
| Ligand Name | 4-fluoro-N-{3-[1-({3-[(4-{5-[(4-fluorobenzene)amido]-1H-indol-3-yl}piperidin-1-yl)methyl]phenyl}methyl)piperidin-4-yl]-1H-indol-5-yl}benzamide |
| PubMed Compound Id | 24881687 |
| Structure | |
| Molecular Formula | C48H46F2N6O2 |
| Molecular Weight | 776.9 |
| SMILES | C1CN(CCC1C2=CNC3=C2C=C(C=C3)NC(=O)C4=CC=C(C=C4)F)CC5=CC(=CC=C5)CN6CCC(CC6)C7=CNC8=C7C=C(C=C8)NC(=O)C9=CC=C(C=C9)F |
| Synonyms | CHEMBL451394 BDBM50271062 PD090226 4-fluoro-N-{3-[1-({3-[(4-{5-[(4-fluorobenzene)amido]-1H-indol-3-yl}piperidin-1-yl)methyl]phenyl}methyl)piperidin-4-yl]-1H-indol-5-yl}benzamide |
| Created At | Jan 13, 2025 2:47 pm |
| Updated At | Jan 13, 2025 2:47 pm |