4-fluoro-N-(3-{1-[2-(2-{2-[2-(4-{5-[(4-fluorobenzene)amido]-1H-indol-3-yl}piperidin-1-yl)ethoxy]ethoxy}ethoxy)ethyl]piperidin-4-yl}-1H-indol-5-yl)benzamide
Test Ligands Values Explained
- Test Ligand ID - A unique identifier for the test ligand
- Ligand Name - Name of the test ligand
| Test Ligand ID | 9506 |
|---|---|
| Ligand Name | 4-fluoro-N-(3-{1-[2-(2-{2-[2-(4-{5-[(4-fluorobenzene)amido]-1H-indol-3-yl}piperidin-1-yl)ethoxy]ethoxy}ethoxy)ethyl]piperidin-4-yl}-1H-indol-5-yl)benzamide |
| PubMed Compound Id | 24881686 |
| Structure | |
| Molecular Formula | C48H54F2N6O5 |
| Molecular Weight | 833.0 |
| SMILES | C1CN(CCC1C2=CNC3=C2C=C(C=C3)NC(=O)C4=CC=C(C=C4)F)CCOCCOCCOCCN5CCC(CC5)C6=CNC7=C6C=C(C=C7)NC(=O)C8=CC=C(C=C8)F |
| Synonyms | CHEMBL501645 BDBM50271025 PD090222 4-fluoro-N-(3-{1-[2-(2-{2-[2-(4-{5-[(4-fluorobenzene)amido]-1H-indol-3-yl}piperidin-1-yl)ethoxy]ethoxy}ethoxy)ethyl]piperidin-4-yl}-1H-indol-5-yl)benzamide |
| Created At | Jan 13, 2025 2:47 pm |
| Updated At | Jan 13, 2025 2:47 pm |