N-(3-{1-[2-carbamoyl-2-(4-{5-[(4-fluorobenzene)amido]-1H-indol-3-yl}piperidin-1-yl)ethyl]piperidin-4-yl}-1H-indol-5-yl)-4-fluorobenzamide
Test Ligands Values Explained
- Test Ligand ID - A unique identifier for the test ligand
- Ligand Name - Name of the test ligand
| Test Ligand ID | 9520 |
|---|---|
| Ligand Name | N-(3-{1-[2-carbamoyl-2-(4-{5-[(4-fluorobenzene)amido]-1H-indol-3-yl}piperidin-1-yl)ethyl]piperidin-4-yl}-1H-indol-5-yl)-4-fluorobenzamide |
| PubMed Compound Id | 24881688 |
| Structure | |
| Molecular Formula | C43H43F2N7O3 |
| Molecular Weight | 743.8 |
| SMILES | C1CN(CCC1C2=CNC3=C2C=C(C=C3)NC(=O)C4=CC=C(C=C4)F)CC(C(=O)N)N5CCC(CC5)C6=CNC7=C6C=C(C=C7)NC(=O)C8=CC=C(C=C8)F |
| Synonyms | CHEMBL453939 BDBM50271064 PD090194 N-(3-{1-[2-carbamoyl-2-(4-{5-[(4-fluorobenzene)amido]-1H-indol-3-yl}piperidin-1-yl)ethyl]piperidin-4-yl}-1H-indol-5-yl)-4-fluorobenzamide |
| Created At | Jan 13, 2025 2:47 pm |
| Updated At | Jan 13, 2025 2:47 pm |